cas: 905966-41-8 — see every product listed under this CAS number, including other names
[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]acetonitrile, 95%, 95% (CAS 905966-41-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVKS-250mg |
| cas | 905966-41-8 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1000.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]acetonitrile (CAS 905966-41-8) is a chemical compound with the molecular formula C13H16BNO2 and a molecular weight of 229.08 g/mol. IUPAC name: 2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]acetonitrile. InChIKey: ABRQBFUTHRPJKV-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | 2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]acetonitrile |
| InChIKey | ABRQBFUTHRPJKV-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)CC#N |
Computed by PubChem (NCBI)