CAS 2001005-77-0 appears in our catalog under these names: 2-(4-Isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 1-Isocyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 5g.
2-(4-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2001005-77-0) is a chemical compound with the molecular formula C13H16BNO2 and a molecular weight of 229.08 g/mol. IUPAC name: 2-(4-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LSAGFQFDWYWSHS-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | 2-(4-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LSAGFQFDWYWSHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[N+]#[C-] |
Computed by PubChem (NCBI)