Products 934558-35-7
CAS 934558-35-7 is the registry number for 3-(4,4,6-Trimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 934558-35-7) is a chemical compound with the molecular formula C13H16BNO2 and a molecular weight of 229.08 g/mol. IUPAC name: 3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: HSTJHADZDZUIFL-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2 |
|---|---|
| Molecular weight | 229.08 g/mol |
| IUPAC name | 3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | HSTJHADZDZUIFL-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)