cas: 1185301-94-3 — see every product listed under this CAS number, including other names
[4-(METHYLSULFONYL)MORPHOLIN-2-YL]METHYLAMINE HYDROCHLORIDE, 97%, 97% (CAS 1185301-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105J5-100mg |
| cas | 1185301-94-3 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 2301.20 Pln | |
| Chemat | 10g | 4442.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride (CAS 1185301-94-3) is a chemical compound with the molecular formula C6H15ClN2O3S and a molecular weight of 230.71 g/mol. IUPAC name: (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride. InChIKey: BUNDFUFGYVOJEV-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN2O3S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride |
| InChIKey | BUNDFUFGYVOJEV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCOC(C1)CN.Cl |
Computed by PubChem (NCBI)