cas: 1185301-94-3 — see every product listed under this CAS number, including other names
{[4-(methylsulfonyl)-2-morpholinyl]methyl}amine hydrochloride, 97% (CAS 1185301-94-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F360239-250MG |
| cas | 1185301-94-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2674.08 Pln | |
| Fluorochem | 10g | 5058.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride (CAS 1185301-94-3) is a chemical compound with the molecular formula C6H15ClN2O3S and a molecular weight of 230.71 g/mol. IUPAC name: (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride. InChIKey: BUNDFUFGYVOJEV-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN2O3S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride |
| InChIKey | BUNDFUFGYVOJEV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCOC(C1)CN.Cl |
Computed by PubChem (NCBI)