CAS 1185301-94-3 appears in our catalog under these names: [4-(Methylsulfonyl)morpholin-2-yl]methylamine hydrochloride, 95%, (4-(Methylsulfonyl)morpholin-2-yl)methanamine hydrochloride, 97%, [4-(METHYLSULFONYL)MORPHOLIN-2-YL]METHYLAMINE HYDROCHLORIDE, 97%, 97%, {[4-(methylsulfonyl)-2-morpholinyl]methyl}amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
(4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride (CAS 1185301-94-3) is a chemical compound with the molecular formula C6H15ClN2O3S and a molecular weight of 230.71 g/mol. IUPAC name: (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride. InChIKey: BUNDFUFGYVOJEV-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN2O3S |
|---|---|
| Molecular weight | 230.71 g/mol |
| IUPAC name | (4-methylsulfonylmorpholin-2-yl)methanamine;hydrochloride |
| InChIKey | BUNDFUFGYVOJEV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCOC(C1)CN.Cl |
Computed by PubChem (NCBI)