cas: 579525-46-5 — see every product listed under this CAS number, including other names
[6-(Dimethylamino)pyridin-3-yl]boronic acid, 95% (CAS 579525-46-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076858-250MG |
| cas | 579525-46-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 10g | 1466.17 Pln | |
| Fluorochem | 25g | 3564.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[6-(dimethylamino)-3-pyridinyl]boronic acid (CAS 579525-46-5) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. IUPAC name: [6-(dimethylamino)-3-pyridinyl]boronic acid. InChIKey: NIDRXNINGRRBFV-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 165.99 g/mol |
| IUPAC name | [6-(dimethylamino)-3-pyridinyl]boronic acid |
| InChIKey | NIDRXNINGRRBFV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)