cas: 1167418-12-3 — see every product listed under this CAS number, including other names
{1-[(tert-butoxy)carbonyl]-1H-indazol-5-yl}boronic acid, 95%, 95% (CAS 1167418-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HDQZ-100mg |
| cas | 1167418-12-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2522.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid (CAS 1167418-12-3) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid. InChIKey: UPCYSNYVECFOJZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid |
| InChIKey | UPCYSNYVECFOJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(N=C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)