CAS 1315339-92-4 appears in our catalog under these names: 1-tert-Butoxycarbonylindazole-3-boronic acid, 97%, (1-(tert-Butoxycarbonyl)-1H-indazol-3-yl)boronic acid, 97%, (1-(tert-Butoxycarbonyl)-1H-indazol-3-yl)boronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-3-yl]boronic acid (CAS 1315339-92-4) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-3-yl]boronic acid. InChIKey: CRIFMWKASCWEDL-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-3-yl]boronic acid |
| InChIKey | CRIFMWKASCWEDL-UHFFFAOYSA-N |
| SMILES | B(C1=NN(C2=CC=CC=C12)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)