CAS 1167418-12-3 appears in our catalog under these names: 1-BOC-Indazole-5-boronic acid, 95%, 1-BOC-Indazole-5-boronic acid 95%, {1-[(tert-butoxy)carbonyl]-1H-indazol-5-yl}boronic acid, 95%, 95%, {1-[(tert-butoxy)carbonyl]-1H-indazol-5-yl}boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid (CAS 1167418-12-3) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid. InChIKey: UPCYSNYVECFOJZ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indazol-5-yl]boronic acid |
| InChIKey | UPCYSNYVECFOJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(N=C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)