cas: 1326715-94-9 — see every product listed under this CAS number, including other names
{1-[(tert-butoxy)carbonyl]-1H-pyrrolo[2,3-c]pyridin-3-yl}boronic acid, 97%, 97% (CAS 1326715-94-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121YL-100mg |
| cas | 1326715-94-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 938.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[2,3-c]pyridin-3-yl]boronic acid (CAS 1326715-94-9) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[2,3-c]pyridin-3-yl]boronic acid. InChIKey: NSNINLFIEPKJOF-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[2,3-c]pyridin-3-yl]boronic acid |
| InChIKey | NSNINLFIEPKJOF-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=C1C=CN=C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)