cas: 958457-42-6 — see every product listed under this CAS number, including other names
{4-[3-(trifluoromethyl)phenoxy]phenyl}boronic acid 95% (CAS 958457-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860716-100mg |
| cas | 958457-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 2717.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A860716 |
[4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid (CAS 958457-42-6) is a chemical compound with the molecular formula C13H10BF3O3 and a molecular weight of 282.02 g/mol. IUPAC name: [4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid. InChIKey: CPGMKXOOKRKAFT-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O3 |
|---|---|
| Molecular weight | 282.02 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid |
| InChIKey | CPGMKXOOKRKAFT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)