CAS 958457-42-6 appears in our catalog under these names: (4-[3-(Trifluoromethyl)phenoxy]phenyl)boranediol, 95%, (4-(3-(Trifluoromethyl)phenoxy)phenyl)boronic acid, 95-<97%, {4-(3-(Trifluoromethyl)phenoxy)phenyl}boronic acid, {4-[3-(trifluoromethyl)phenoxy]phenyl}boronic acid 95%, (4-[3-(Trifluoromethyl)phenoxy]phenyl)boranediol, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 2,5g, 25g, 0,5g.
[4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid (CAS 958457-42-6) is a chemical compound with the molecular formula C13H10BF3O3 and a molecular weight of 282.02 g/mol. IUPAC name: [4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid. InChIKey: CPGMKXOOKRKAFT-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O3 |
|---|---|
| Molecular weight | 282.02 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)phenoxy]phenyl]boronic acid |
| InChIKey | CPGMKXOOKRKAFT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)