Products 501944-50-9

CAS 501944-50-9 appears in our catalog under these names: {4-[4-(Trifluoromethoxy)phenyl]phenyl}boronic acid, 98%, (4'-(Trifluoromethoxy)-[1,1'-biphenyl]-4-yl)boronic acid 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

[4-[4-(trifluoromethoxy)phenyl]phenyl]boronic acid (CAS 501944-50-9) is a chemical compound with the molecular formula C13H10BF3O3 and a molecular weight of 282.02 g/mol. IUPAC name: [4-[4-(trifluoromethoxy)phenyl]phenyl]boronic acid. InChIKey: CUFCSCZISVFDAT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BF3O3
Molecular weight282.02 g/mol
IUPAC name[4-[4-(trifluoromethoxy)phenyl]phenyl]boronic acid
InChIKeyCUFCSCZISVFDAT-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC=C(C=C2)OC(F)(F)F)(O)O

Computed by PubChem (NCBI)