cas: 157843-41-9 — see every product listed under this CAS number, including other names
α-L-Galactopyranoside, 2-chloro-4-nitrophenyl 6-deoxy-, 98% (CAS 157843-41-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980095-50MG |
| cas | 157843-41-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 450.90 Pln | |
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 2569.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol (CAS 157843-41-9) is a chemical compound with the molecular formula C12H14ClNO7 and a molecular weight of 319.69 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol. InChIKey: QURSGHQPKUXLAD-MOBXTKCLSA-N.
| Molecular formula | C12H14ClNO7 |
|---|---|
| Molecular weight | 319.69 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol |
| InChIKey | QURSGHQPKUXLAD-MOBXTKCLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)O)O)O |
Computed by PubChem (NCBI)