cas: 157843-41-9 — see every product listed under this CAS number, including other names
CNP-AFU 98+% (CAS 157843-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A543280-100mg |
| cas | 157843-41-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1277.06 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A543280 |
(2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol (CAS 157843-41-9) is a chemical compound with the molecular formula C12H14ClNO7 and a molecular weight of 319.69 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol. InChIKey: QURSGHQPKUXLAD-MOBXTKCLSA-N.
| Molecular formula | C12H14ClNO7 |
|---|---|
| Molecular weight | 319.69 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol |
| InChIKey | QURSGHQPKUXLAD-MOBXTKCLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)O)O)O |
Computed by PubChem (NCBI)