CAS 157843-41-9 appears in our catalog under these names: 2-Chloro-4-nitrophenyl-alpha-l-fucopyranoside, 98%, CNP-AFU, 98+%, CNP-AFU/ 97.93% (existing batch purity), CNP–AFU (2–Chloro–4–nitrophenyl α–L–fucopyranoside), 2-Chloro-4-nitrophenyl-alpha-L-fucopyranoside. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 25mg, 50mg, 100mg, 200mg, 10mg.
(2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol (CAS 157843-41-9) is a chemical compound with the molecular formula C12H14ClNO7 and a molecular weight of 319.69 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol. InChIKey: QURSGHQPKUXLAD-MOBXTKCLSA-N.
| Molecular formula | C12H14ClNO7 |
|---|---|
| Molecular weight | 319.69 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-(2-chloro-4-nitrophenoxy)-6-methyloxane-3,4,5-triol |
| InChIKey | QURSGHQPKUXLAD-MOBXTKCLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)O)O)O |
Computed by PubChem (NCBI)