cas: 152831-36-2 — see every product listed under this CAS number, including other names
α-Hydroxy-α-phosphono-3-pyridinepropanoic acid, 99%, 99% (CAS 152831-36-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPM0-1mg |
| cas | 152831-36-2 |
| size | 1mg |
| availability | 2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 218.00 Pln | |
| Chemat | 5mg | 237.20 Pln | |
| Chemat | 10mg | 366.80 Pln | |
| Chemat | 50mg | 1086.80 Pln | |
| Chemat | 100mg | 1802.00 Pln | |
| Chemat | 250mg | 3021.20 Pln | |
| Chemat | 1g | 8411.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid (CAS 152831-36-2) is a chemical compound with the molecular formula C8H10NO6P and a molecular weight of 247.14 g/mol. IUPAC name: 2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid. InChIKey: FJVYPXVLXQXDHM-UHFFFAOYSA-N.
| Molecular formula | C8H10NO6P |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid |
| InChIKey | FJVYPXVLXQXDHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC(C(=O)O)(O)P(=O)(O)O |
Computed by PubChem (NCBI)