CAS 152831-36-2 appears in our catalog under these names: 2-HYDROXY-2-PHOSPHONO-3-(PYRIDIN-3-YL)PROPANOIC ACID, 99%, 3-PEHPC, >95% (HPLC), NE 10790/ 100%, NE 10790 (3–PEHPC), NE 10790. Offered by: Fluorochem, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 25mg, 2mg.
2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid (CAS 152831-36-2) is a chemical compound with the molecular formula C8H10NO6P and a molecular weight of 247.14 g/mol. IUPAC name: 2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid. InChIKey: FJVYPXVLXQXDHM-UHFFFAOYSA-N.
| Molecular formula | C8H10NO6P |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 2-hydroxy-2-phosphono-3-pyridin-3-ylpropanoic acid |
| InChIKey | FJVYPXVLXQXDHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC(C(=O)O)(O)P(=O)(O)O |
Computed by PubChem (NCBI)