cas: 40846-94-4 — see every product listed under this CAS number, including other names
α-Lipoic acid-NHS 98% (CAS 40846-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A748349-250mg |
| cas | 40846-94-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2072.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A748349 |
(2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate (CAS 40846-94-4) is a chemical compound with the molecular formula C12H17NO4S2 and a molecular weight of 303.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate. InChIKey: WBCUIGFYTHUQHZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate |
| InChIKey | WBCUIGFYTHUQHZ-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)