cas: 40846-94-4 — see every product listed under this CAS number, including other names
DL-alpha-Lipoic Acid-NHS, >96.0%(HPLC) (CAS 40846-94-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | L0345-50MG |
| cas | 40846-94-4 |
| size | 50mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 50mg | 473.88 Pln | |
| TCI | 250mg | 1496.66 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(HPLC) |
(2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate (CAS 40846-94-4) is a chemical compound with the molecular formula C12H17NO4S2 and a molecular weight of 303.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate. InChIKey: WBCUIGFYTHUQHZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate |
| InChIKey | WBCUIGFYTHUQHZ-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)