cas: 40846-94-4 — see every product listed under this CAS number, including other names
2,5-Pyrrolidinedione, 1-[[5-(1,2-dithiolan-3-yl)-1-oxopentyl]oxy]-, 98% (CAS 40846-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863117-250MG |
| cas | 40846-94-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 5g | 1976.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate (CAS 40846-94-4) is a chemical compound with the molecular formula C12H17NO4S2 and a molecular weight of 303.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate. InChIKey: WBCUIGFYTHUQHZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-(dithiolan-3-yl)pentanoate |
| InChIKey | WBCUIGFYTHUQHZ-UHFFFAOYSA-N |
| SMILES | C1CSSC1CCCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)