cas: 3006-60-8 — see every product listed under this CAS number, including other names
β-D-Galactosamine pentaacetate, 99.58% (CAS 3006-60-8) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 10 g, 1 g, 25 g, 50 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W005729-100 g |
| cas | 3006-60-8 |
| size | 100 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 2037.97 Pln | |
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 25 g | 872.33 Pln | |
| MedChemExpress | 50 g | 1318.15 Pln | |
| MedChemExpress | 5 g | 361.49 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.58% |
[(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 3006-60-8) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-IBEHDNSVSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-IBEHDNSVSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)