cas: 3006-60-8 — see every product listed under this CAS number, including other names
2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose, 95.00% (CAS 3006-60-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 2g, 50g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM88240C-10g |
| cas | 3006-60-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2567.35 Pln | |
| Chemat | 25g | 4742.44 Pln | |
| Chemat | 2g | 1331.35 Pln | |
| Chemat | 50g | 7560.68 Pln | |
| Chemat | 5g | 1776.66 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 95.00% |
| category | Chemicals |
[(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 3006-60-8) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-IBEHDNSVSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-IBEHDNSVSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)