8-Hydroxyquinolinolato-lithium, 99.5% (CAS 25387-93-3) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E301-1g |
| cas | 25387-93-3 |
| size | 1g |
| availability | 12.11.2021: In Stock |
| purity | 99.5% |
|---|
Lithium quinolin-8-olate (CAS 25387-93-3) is a chemical compound with the molecular formula C9H6LiNO and a molecular weight of 151.1 g/mol. IUPAC name: lithium quinolin-8-olate. InChIKey: FQHFBFXXYOQXMN-UHFFFAOYSA-M.
| Molecular formula | C9H6LiNO |
|---|---|
| Molecular weight | 151.1 g/mol |
| IUPAC name | lithium quinolin-8-olate |
| InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=C(C(=C1)[O-])N=CC=C2 |
Computed by PubChem (NCBI)