1',3',5'-Triphenyl-1'H-1,4'-bipyrazole, 98%
cas: 894085-99-5 — see every product listed under this CAS number, including other names
1',3',5'-Triphenyl-1'H-1,4'-bipyrazole, 98% (CAS 894085-99-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1326432-250mg |
| cas | 894085-99-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2267.19 Pln | |
| Ambeed | 25g | 7729.56 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 678.80 Pln | |
| Chemat | 5g | 1974.80 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 747.54 Pln | |
| BLDpharm | 5g | 2435.83 Pln | |
| BLDpharm | 25g | 8333.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,3,5-triphenyl-4-pyrazol-1-ylpyrazole (CAS 894085-99-5) is a chemical compound with the molecular formula C24H18N4 and a molecular weight of 362.4 g/mol. IUPAC name: 1,3,5-triphenyl-4-pyrazol-1-ylpyrazole. InChIKey: YGEDFNCNIQNZNA-UHFFFAOYSA-N.
| Molecular formula | C24H18N4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 1,3,5-triphenyl-4-pyrazol-1-ylpyrazole |
| InChIKey | YGEDFNCNIQNZNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NN2C3=CC=CC=C3)C4=CC=CC=C4)N5C=CC=N5 |
Computed by PubChem (NCBI)