CAS 861659-70-3 appears in our catalog under these names: 4,4'–(1,10–Phenanthroline–2,9–diyl)dianiline, 4,4'-(1,10-Phenanthroline-2,9-diyl)dianiline, 97%, 97%, 4,4'-(1,10-Phenanthroline-2,9-diyl)dianiline, 96%, 4,4'-(1,10-Phenanthroline-2,9-diyl)dianiline, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[9-(4-aminophenyl)-1,10-phenanthrolin-2-yl]aniline (CAS 861659-70-3) is a chemical compound with the molecular formula C24H18N4 and a molecular weight of 362.4 g/mol. IUPAC name: 4-[9-(4-aminophenyl)-1,10-phenanthrolin-2-yl]aniline. InChIKey: QWVPZNAGYLSYEH-UHFFFAOYSA-N.
| Molecular formula | C24H18N4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-[9-(4-aminophenyl)-1,10-phenanthrolin-2-yl]aniline |
| InChIKey | QWVPZNAGYLSYEH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)C4=CC=C(C=C4)N)N=C(C=C2)C5=CC=C(C=C5)N |
Computed by PubChem (NCBI)