CAS 894085-99-5 appears in our catalog under these names: 1',3',5'-Triphenyl-1'H-1,4'-bipyrazole, 98%, 98%, 1',3',5'-Triphenyl-1'H-1,4'-bipyrazole, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
1,3,5-triphenyl-4-pyrazol-1-ylpyrazole (CAS 894085-99-5) is a chemical compound with the molecular formula C24H18N4 and a molecular weight of 362.4 g/mol. IUPAC name: 1,3,5-triphenyl-4-pyrazol-1-ylpyrazole. InChIKey: YGEDFNCNIQNZNA-UHFFFAOYSA-N.
| Molecular formula | C24H18N4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 1,3,5-triphenyl-4-pyrazol-1-ylpyrazole |
| InChIKey | YGEDFNCNIQNZNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NN2C3=CC=CC=C3)C4=CC=CC=C4)N5C=CC=N5 |
Computed by PubChem (NCBI)