cas: 27473-61-6 — see every product listed under this CAS number, including other names
1',3'-Dihydrospiro[imidazolidine-4,2'-indene]-2,5-dione (CAS 27473-61-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFCD-5mg |
| cas | 27473-61-6 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
Spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (CAS 27473-61-6) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione. InChIKey: AKYSWRIZYDOSDE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| InChIKey | AKYSWRIZYDOSDE-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC13C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)