CAS 562803-68-3 appears in our catalog under these names: 3-Pyrazol-1-ylmethyl-benzoic acid, 97%, 3-(1H-Pyrazol-1-ylmethyl)benzoic acid, 95%, 3-((1H-Pyrazol-1-yl)methyl)benzoic acid, 95%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg.
3-(pyrazol-1-ylmethyl)benzoic acid (CAS 562803-68-3) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(pyrazol-1-ylmethyl)benzoic acid. InChIKey: UMYNAPRDOSIHOY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(pyrazol-1-ylmethyl)benzoic acid |
| InChIKey | UMYNAPRDOSIHOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CN2C=CC=N2 |
Computed by PubChem (NCBI)