CAS 68752-87-4 appears in our catalog under these names: Ethyl 2-cyano-3-(pyridin-2-yl)acrylate, 95%, Ethyl (E)–2–cyano–3–(pyridin–2–yl)acrylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
Ethyl (E)-2-cyano-3-pyridin-2-ylprop-2-enoate (CAS 68752-87-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: ethyl (E)-2-cyano-3-pyridin-2-ylprop-2-enoate. InChIKey: ZVPIXOUQAVXJRI-VQHVLOKHSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-pyridin-2-ylprop-2-enoate |
| InChIKey | ZVPIXOUQAVXJRI-VQHVLOKHSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC=N1)/C#N |
Computed by PubChem (NCBI)