cas: 946135-52-0 — see every product listed under this CAS number, including other names
1'-(tert-Butoxycarbonyl)-2-oxospiro(indoline-3,4'-piperidine)-5-carboxylic acid, 98+% (CAS 946135-52-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A288005-5g |
| cas | 946135-52-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 38153.50 Pln | |
| AmBeed | 1g | 12256.72 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1'-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxospiro[1H-indole-3,4'-piperidine]-5-carboxylic acid (CAS 946135-52-0) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: 1'-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxospiro[1H-indole-3,4'-piperidine]-5-carboxylic acid. InChIKey: FDYMBJJXDJNNJU-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1'-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxospiro[1H-indole-3,4'-piperidine]-5-carboxylic acid |
| InChIKey | FDYMBJJXDJNNJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC(=C3)C(=O)O)NC2=O |
Computed by PubChem (NCBI)