Products 876147-52-3

CAS 876147-52-3 is the registry number for (N-BOC-Morpholin-2-yl)methyl phthalimide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]morpholine-4-carboxylate (CAS 876147-52-3) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]morpholine-4-carboxylate. InChIKey: YGEBKFZXBQXUAK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N2O5
Molecular weight346.4 g/mol
IUPAC nametert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]morpholine-4-carboxylate
InChIKeyYGEBKFZXBQXUAK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOC(C1)CN2C(=O)C3=CC=CC=C3C2=O

Computed by PubChem (NCBI)