CAS 7360-23-8 appears in our catalog under these names: Z-Pro-pro-oh, 97%, Z–Pro–Pro–OH, Z-Pro-Pro-OH, 97%, 97%, Z-Pro-Pro, Cbz-Pro-Pro-OH, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 1 g, 5 g, 10 g, 100g.
1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid (CAS 7360-23-8) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: GEAZFVPWHCGNLW-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | GEAZFVPWHCGNLW-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)