cas: 367500-88-7 — see every product listed under this CAS number, including other names
1'-Boc-[1,4']bipiperidinyl-4-ol, 97% (CAS 367500-88-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061582-1G |
| cas | 367500-88-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 2580.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate (CAS 367500-88-7) is a chemical compound with the molecular formula C15H28N2O3 and a molecular weight of 284.39 g/mol. IUPAC name: tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate. InChIKey: NHZHORRSIJNTSZ-UHFFFAOYSA-N.
| Molecular formula | C15H28N2O3 |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | tert-butyl 4-(4-hydroxypiperidin-1-yl)piperidine-1-carboxylate |
| InChIKey | NHZHORRSIJNTSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2CCC(CC2)O |
Computed by PubChem (NCBI)