Products 2641451-54-7
CAS 2641451-54-7 is the registry number for tert-Butyl N-methyl-N-((S)-pyrrolidine-3-carbonyl)-L-valinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-3-methyl-2-[methyl-[(3S)-pyrrolidine-3-carbonyl]amino]butanoate (CAS 2641451-54-7) is a chemical compound with the molecular formula C15H28N2O3 and a molecular weight of 284.39 g/mol. IUPAC name: tert-butyl (2S)-3-methyl-2-[methyl-[(3S)-pyrrolidine-3-carbonyl]amino]butanoate. InChIKey: ZNPYFBSKKIAOMG-RYUDHWBXSA-N.
| Molecular formula | C15H28N2O3 |
|---|---|
| Molecular weight | 284.39 g/mol |
| IUPAC name | tert-butyl (2S)-3-methyl-2-[methyl-[(3S)-pyrrolidine-3-carbonyl]amino]butanoate |
| InChIKey | ZNPYFBSKKIAOMG-RYUDHWBXSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N(C)C(=O)[C@H]1CCNC1 |
Computed by PubChem (NCBI)