CAS 1205-90-9 appears in our catalog under these names: 1,1'-(1,4-Phenylene)diurea, 95%, 1,1'–(1,4–Phenylene)diurea, 1,1'-(1,4-Phenylene)diurea, 1,1'-(1,4-Phenylene)diurea, >98.0%(HPLC)(qNMR), 1,1'-(1,4-Phenylene)diurea, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 250mg, 500mg, 5g, 10g, 100mg.
[4-(carbamoylamino)phenyl]urea (CAS 1205-90-9) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: [4-(carbamoylamino)phenyl]urea. InChIKey: DPRNGQDPBFKLCK-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | [4-(carbamoylamino)phenyl]urea |
| InChIKey | DPRNGQDPBFKLCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)NC(=O)N |
Computed by PubChem (NCBI)