CAS 885960-32-7 is the registry number for 1,2-Diamidoximobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-N',2-N'-dihydroxybenzene-1,2-dicarboximidamide (CAS 885960-32-7) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: 1-N',2-N'-dihydroxybenzene-1,2-dicarboximidamide. InChIKey: ABLRNIOEOXBEEN-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 1-N',2-N'-dihydroxybenzene-1,2-dicarboximidamide |
| InChIKey | ABLRNIOEOXBEEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N/O)/N)/C(=N/O)/N |
Computed by PubChem (NCBI)