Products 15266-88-3
CAS 15266-88-3 appears in our catalog under these names: Cyclo(-gly-his), 95%, Cyclo(Gly-His), 95+%, Cyclo(–Gly–His), Cyclo(Gly-His). Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, Get quote.
(3S)-3-(1H-imidazol-5-ylmethyl)piperazine-2,5-dione (CAS 15266-88-3) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: (3S)-3-(1H-imidazol-5-ylmethyl)piperazine-2,5-dione. InChIKey: FYFJTCMGWLBLPG-LURJTMIESA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | (3S)-3-(1H-imidazol-5-ylmethyl)piperazine-2,5-dione |
| InChIKey | FYFJTCMGWLBLPG-LURJTMIESA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CC2=CN=CN2 |
Computed by PubChem (NCBI)