1,1'-(4-(Trifluoromethyl)pyridine-2,6-diyl)diethanone, 97%
cas: 210155-51-4 — see every product listed under this CAS number, including other names
1,1'-(4-(Trifluoromethyl)pyridine-2,6-diyl)diethanone, 97% (CAS 210155-51-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A660360-250mg |
| cas | 210155-51-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1644.19 Pln | |
| Ambeed | 1g | 4314.19 Pln | |
| Chemat | 50mg | 592.40 Pln | |
| Chemat | 100mg | 962.00 Pln | |
| Chemat | 250mg | 1590.80 Pln | |
| Chemat | 1g | 4187.60 Pln | |
| BLDpharm | 50mg | 614.25 Pln | |
| BLDpharm | 100mg | 980.79 Pln | |
| BLDpharm | 250mg | 1613.90 Pln | |
| BLDpharm | 1g | 4235.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-[6-acetyl-4-(trifluoromethyl)-2-pyridinyl]ethanone (CAS 210155-51-4) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-[6-acetyl-4-(trifluoromethyl)-2-pyridinyl]ethanone. InChIKey: BGDQJDBYLXYIMD-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 1-[6-acetyl-4-(trifluoromethyl)-2-pyridinyl]ethanone |
| InChIKey | BGDQJDBYLXYIMD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=N1)C(=O)C)C(F)(F)F |
Computed by PubChem (NCBI)