CAS 189940-07-6 appears in our catalog under these names: 2-Methyl-6-(trifluoromethyl)-2h-1,4-benzoxazin-3(4h)-one, 95%, 2-Methyl-6-(trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
2-methyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 189940-07-6) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 2-methyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: WZIHGKCKNMYGFV-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 2-methyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | WZIHGKCKNMYGFV-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)