Products 1190198-26-5
CAS 1190198-26-5 is the registry number for 5-Methoxy-6-(trifluoromethyl)-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-methoxy-6-(trifluoromethyl)-1,3-dihydroindol-2-one (CAS 1190198-26-5) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 5-methoxy-6-(trifluoromethyl)-1,3-dihydroindol-2-one. InChIKey: ASXQIFMMGBUAEZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 5-methoxy-6-(trifluoromethyl)-1,3-dihydroindol-2-one |
| InChIKey | ASXQIFMMGBUAEZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(=O)N2)C(F)(F)F |
Computed by PubChem (NCBI)