CAS 6683-48-3 appears in our catalog under these names: 1,1,4,4,6-Pentamethyl-1,2,3,4-tetrahydronaphthalene, 1,1,4,4,6–Pentamethyl–1,2,3,4–tetrahydronaphthalene, Naphthalene, 1,2,3,4-tetrahydro-1,1,4,4,6-pentamethyl-, 97%, 97%, 1,1,4,4,6-Pentamethyl-1,2,3,4-tetrahydronaphthalene, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 500g, 5g, 100g.
1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene (CAS 6683-48-3) is a chemical compound with the molecular formula C15H22 and a molecular weight of 202.33 g/mol. IUPAC name: 1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene. InChIKey: AISXBZVAYNUAKB-UHFFFAOYSA-N.
| Molecular formula | C15H22 |
|---|---|
| Molecular weight | 202.33 g/mol |
| IUPAC name | 1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene |
| InChIKey | AISXBZVAYNUAKB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)