cas: 1010-26-0 — see every product listed under this CAS number, including other names
1,1-Cyclohexanediacetic acidanhydride, 95% (CAS 1010-26-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209890-25G |
| cas | 1010-26-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 50g | 200.99 Pln | |
| Fluorochem | 100g | 289.50 Pln | |
| Fluorochem | 1g | 96.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-oxaspiro[5.5]undecane-2,4-dione (CAS 1010-26-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 3-oxaspiro[5.5]undecane-2,4-dione. InChIKey: XNDSIASQMRYFSW-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-oxaspiro[5.5]undecane-2,4-dione |
| InChIKey | XNDSIASQMRYFSW-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)OC(=O)C2 |
Computed by PubChem (NCBI)