CAS 106237-17-6 appears in our catalog under these names: 2-oxatricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid, 95%, 2-Oxaadamantane-1-carboxylic acid, 95+%, 2–Oxaadamantane–1–carboxylic acid, 2-Oxatricyclo(3.3.1.1,3,7)decane-1-carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
2-oxatricyclo[3.3.1.13,7]decane-1-carboxylic acid (CAS 106237-17-6) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 2-oxatricyclo[3.3.1.13,7]decane-1-carboxylic acid. InChIKey: SDGBFSSBRFDOKB-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-oxatricyclo[3.3.1.13,7]decane-1-carboxylic acid |
| InChIKey | SDGBFSSBRFDOKB-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(O3)C(=O)O |
Computed by PubChem (NCBI)