CAS 1010-26-0 appears in our catalog under these names: 1,1-Cyclohexanediacetic anhydride, 97%, 1,1–Cyclohexanediacetic anhydride, 1,1-Cyclohexanediacetic Anhydride, >98.0%(GC), 1,1-Cyclohexanediacetic acid anhydride, 1,1-Cyclohexanediacetic Anhydride 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 5g, 25g, 100g, 10g, 1g, 50g, 500g.
3-oxaspiro[5.5]undecane-2,4-dione (CAS 1010-26-0) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 3-oxaspiro[5.5]undecane-2,4-dione. InChIKey: XNDSIASQMRYFSW-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-oxaspiro[5.5]undecane-2,4-dione |
| InChIKey | XNDSIASQMRYFSW-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)OC(=O)C2 |
Computed by PubChem (NCBI)