cas: 869852-13-1 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 98%, 98% (CAS 869852-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H4PF-100mg |
| cas | 869852-13-1 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 818.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 869852-13-1) is a chemical compound with the molecular formula C20H28BNO4 and a molecular weight of 357.3 g/mol. IUPAC name: tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: XYUZBXNCRMPFHN-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO4 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | XYUZBXNCRMPFHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=CC=CC=C3N2C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)