cas: 869852-13-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 98% (CAS 869852-13-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F697013-1G |
| cas | 869852-13-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 888.25 Pln | |
| Fluorochem | 10g | 1716.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 869852-13-1) is a chemical compound with the molecular formula C20H28BNO4 and a molecular weight of 357.3 g/mol. IUPAC name: tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: XYUZBXNCRMPFHN-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO4 |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | tert-butyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | XYUZBXNCRMPFHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=CC=CC=C3N2C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)