cas: 886851-28-1 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate, 95+%, 95+% (CAS 886851-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1158UQ-100mg |
| cas | 886851-28-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 923.60 Pln | |
| Chemat | 500mg | 170.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate (CAS 886851-28-1) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate. InChIKey: JKLFDXDBLLWDNO-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate |
| InChIKey | JKLFDXDBLLWDNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CC=N1)F |
Computed by PubChem (NCBI)