CAS 1248655-94-8 appears in our catalog under these names: 2-Amino-5-(tert-butylamino)-4-fluorobenzoic acid, 95%, 2-Amino-5-(tert-butylamino)-4-fluorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-amino-5-(tert-butylamino)-4-fluorobenzoic acid (CAS 1248655-94-8) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: 2-amino-5-(tert-butylamino)-4-fluorobenzoic acid. InChIKey: UMNMXJZHBFJIQF-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-amino-5-(tert-butylamino)-4-fluorobenzoic acid |
| InChIKey | UMNMXJZHBFJIQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=C(C(=C1)C(=O)O)N)F |
Computed by PubChem (NCBI)